C23H29BrN2O3 — CID 18553328
3-(3,4-dimethoxyphenyl)-1-(3-methylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide (PubChem CID 18553328) has the molecular formula C23H29BrN2O3 and a molecular weight of 461.40 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-(3-methylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-(3-methylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide |
|---|---|
| PubChem CID | 18553328 |
| Molecular Formula | C23H29BrN2O3 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-(3-methylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide |
| SMILES | COc1ccc(C2(O)CN(c3cccc(C)c3)C3=[N+]2CCCCC3)cc1OC.[Br-] |
| InChI | InChI=1S/C23H29N2O3.BrH/c1-17-8-7-9-19(14-17)24-16-23(26,25-13-6-4-5-10-22(24)25)18-11-12-20(27-2)21(15-18)28-3;/h7-9,11-12,14-15,26H,4-6,10,13,16H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | VPGKFAFFZTYXMS-UHFFFAOYSA-M |
| XLogP | 0.67 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|