C20H19FN4OS — CID 18553988
4-(4-fluorophenyl)-N-(3-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide (PubChem CID 18553988) has the molecular formula C20H19FN4OS and a molecular weight of 382.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(3-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide.
| Compound Name | 4-(4-fluorophenyl)-N-(3-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 18553988 |
| Molecular Formula | C20H19FN4OS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(3-methoxyphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carbothioamide |
| SMILES | COc1cccc(NC(=S)N2CCc3[nH]cnc3C2c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H19FN4OS/c1-26-16-4-2-3-15(11-16)24-20(27)25-10-9-17-18(23-12-22-17)19(25)13-5-7-14(21)8-6-13/h2-8,11-12,19H,9-10H2,1H3,(H,22,23)(H,24,27) |
| InChIKey | WVTPHILXAMCCKS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|