C20H25N2O4S- — CID 18555804
(1R,2S,3R,4R)-3-[[(6R)-3-carbamoyl-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 18555804) has the molecular formula C20H25N2O4S- and a molecular weight of 389.50 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-[[(6R)-3-carbamoyl-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (1R,2S,3R,4R)-3-[[(6R)-3-carbamoyl-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 18555804 |
| Molecular Formula | C20H25N2O4S- |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (1R,2S,3R,4R)-3-[[(6R)-3-carbamoyl-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC[C@@H]1CCc2c(sc(NC(=O)[C@@H]3[C@@H]4CC[C@H](C4)[C@@H]3C(=O)[O-])c2C(N)=O)C1 |
| InChI | InChI=1S/C20H26N2O4S/c1-2-9-3-6-12-13(7-9)27-19(16(12)17(21)23)22-18(24)14-10-4-5-11(8-10)15(14)20(25)26/h9-11,14-15H,2-8H2,1H3,(H2,21,23)(H,22,24)(H,25,26)/p-1/t9-,10-,11-,14-,15+/m1/s1 |
| InChIKey | JVAJUSPXMOZCSN-XBIAIPMCSA-M |
| XLogP | 1.71 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |