C25H30N2O — CID 18555899
(1S,2R,7R,8S,9S)-8-phenyl-13-(phenylhydrazinylidene)tricyclo[7.3.1.02,7]tridecan-2-ol (PubChem CID 18555899) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is (1S,2R,7R,8S,9S)-8-phenyl-13-(phenylhydrazinylidene)tricyclo[7.3.1.02,7]tridecan-2-ol.
| Compound Name | (1S,2R,7R,8S,9S)-8-phenyl-13-(phenylhydrazinylidene)tricyclo[7.3.1.02,7]tridecan-2-ol |
|---|---|
| PubChem CID | 18555899 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | (1S,2R,7R,8S,9S)-8-phenyl-13-(phenylhydrazinylidene)tricyclo[7.3.1.02,7]tridecan-2-ol |
| SMILES | O[C@]12CCCC[C@@H]1[C@@H](c1ccccc1)[C@@H]1CCC[C@H]2C1=NNc1ccccc1 |
| InChI | InChI=1S/C25H30N2O/c28-25-17-8-7-15-21(25)23(18-10-3-1-4-11-18)20-14-9-16-22(25)24(20)27-26-19-12-5-2-6-13-19/h1-6,10-13,20-23,26,28H,7-9,14-17H2/t20-,21+,22-,23-,25+/m0/s1 |
| InChIKey | QYOXYFORJPSJMA-GPUWNAPISA-N |
| XLogP | 5.59 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|