C17H16N2O3 — CID 18555953
(1S,2R,6R,7S,8R,12S)-5-(4-methylphenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione (PubChem CID 18555953) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R,12S)-5-(4-methylphenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione.
| Compound Name | (1S,2R,6R,7S,8R,12S)-5-(4-methylphenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
|---|---|
| PubChem CID | 18555953 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (1S,2R,6R,7S,8R,12S)-5-(4-methylphenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
| SMILES | Cc1ccc(C2=NO[C@@H]3[C@H]4C[C@H]([C@H]5C(=O)NC(=O)[C@@H]45)[C@H]23)cc1 |
| InChI | InChI=1S/C17H16N2O3/c1-7-2-4-8(5-3-7)14-13-9-6-10(15(13)22-19-14)12-11(9)16(20)18-17(12)21/h2-5,9-13,15H,6H2,1H3,(H,18,20,21)/t9-,10+,11-,12+,13-,15-/m1/s1 |
| InChIKey | ZHPQYCJLZIECGW-RGOPTCMMSA-N |
| XLogP | 1.25 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|