C18H19ClNO3- — CID 18557569
(1S,2S,3S,4S)-3-[2-(3-chlorophenyl)ethylcarbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 18557569) has the molecular formula C18H19ClNO3- and a molecular weight of 332.81 g/mol. Its IUPAC name is (1S,2S,3S,4S)-3-[2-(3-chlorophenyl)ethylcarbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | (1S,2S,3S,4S)-3-[2-(3-chlorophenyl)ethylcarbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18557569 |
| Molecular Formula | C18H19ClNO3- |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (1S,2S,3S,4S)-3-[2-(3-chlorophenyl)ethylcarbamoyl]bicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1[C@@H](C(=O)NCCc2cccc(Cl)c2)[C@@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C18H20ClNO3/c19-14-3-1-2-11(10-14)8-9-20-17(21)15-12-4-6-13(7-5-12)16(15)18(22)23/h1-4,6,10,12-13,15-16H,5,7-9H2,(H,20,21)(H,22,23)/p-1/t12-,13-,15+,16+/m1/s1 |
| InChIKey | JLDWZGLMMQQRNA-VDERGJSUSA-M |
| XLogP | 1.58 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|