C20H25ClN2OS — CID 18558299
2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-1-[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinan-3-yl]ethanone (PubChem CID 18558299) has the molecular formula C20H25ClN2OS and a molecular weight of 376.95 g/mol. Its IUPAC name is 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-1-[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinan-3-yl]ethanone.
| Compound Name | 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-1-[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinan-3-yl]ethanone |
|---|---|
| PubChem CID | 18558299 |
| Molecular Formula | C20H25ClN2OS |
| Molecular Weight | 376.95 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-1-[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinan-3-yl]ethanone |
| SMILES | Cc1ccc(/N=C2\SCCCN2C(=O)C[C@@H]2C[C@@H]3CC[C@@H]2C3)cc1Cl |
| InChI | InChI=1S/C20H25ClN2OS/c1-13-3-6-17(12-18(13)21)22-20-23(7-2-8-25-20)19(24)11-16-10-14-4-5-15(16)9-14/h3,6,12,14-16H,2,4-5,7-11H2,1H3/b22-20-/t14-,15-,16+/m1/s1 |
| InChIKey | HKCSWAAPCVUUSP-XFYOIMAQSA-N |
| XLogP | 5.43 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.95 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|