C12H15BrN2O2S — CID 18558732
methyl 4-[(2-imino-1,3-thiazolidin-3-yl)methyl]benzoate;hydrobromide (PubChem CID 18558732) has the molecular formula C12H15BrN2O2S and a molecular weight of 331.24 g/mol. Its IUPAC name is methyl 4-[(2-imino-1,3-thiazolidin-3-yl)methyl]benzoate;hydrobromide.
| Compound Name | methyl 4-[(2-imino-1,3-thiazolidin-3-yl)methyl]benzoate;hydrobromide |
|---|---|
| PubChem CID | 18558732 |
| Molecular Formula | C12H15BrN2O2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | methyl 4-[(2-imino-1,3-thiazolidin-3-yl)methyl]benzoate;hydrobromide |
| SMILES | Br.[H]/N=C1\SCCN1Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C12H14N2O2S.BrH/c1-16-11(15)10-4-2-9(3-5-10)8-14-6-7-17-12(14)13;/h2-5,13H,6-8H2,1H3;1H/b13-12-; |
| InChIKey | NMIXWGIPVXWVRK-USGGBSEESA-N |
| XLogP | 2.53 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|