About benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine
benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine (PubChem CID 18558743) has the molecular formula C23H18N2O3S2
and a molecular weight of 434.54 g/mol. Its IUPAC name is benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine.
Molecular Properties
| Compound Name | benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine |
| PubChem CID | 18558743 |
| Molecular Formula | C23H18N2O3S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine |
| SMILES | Nc1c(-c2ccccc2)sc2ccc3ccccc3[n+]12.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C17H13N2S.C6H6O3S/c18-17-16(13-7-2-1-3-8-13)20-15-11-10-12-6-4-5-9-14(12)19(15)17;7-10(8,9)6-4-2-1-3-5-6/h1-11H,18H2;1-5H,(H,7,8,9)/q+1;/p-1 |
| InChIKey | VFJOZFNXKLCZBH-UHFFFAOYSA-M |
| XLogP | 4.48 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine?
The IUPAC name of benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine (CID 18558743) is benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine.
What is the SMILES notation for benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine?
The canonical SMILES for benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine is Nc1c(-c2ccccc2)sc2ccc3ccccc3[n+]12.O=S(=O)([O-])c1ccccc1.
What is the InChIKey of benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine?
The InChIKey is VFJOZFNXKLCZBH-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H13N2S.C6H6O3S/c18-17-16(13-7-2-1-3-8-13)20-15-11-10-12-6-4-5-9-14(12)19(15)17;7-10(8,9)6-4-2-1-3-5-6/h1-11H,18H2;1-5H,(H,7,8,9)/q+1;/p-1.
What are the key properties of benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine?
benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine has a molecular weight of 434.54 g/mol, XLogP of 4.48, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonate;2-phenyl-[1,3]thiazolo[3,2-a]quinolin-10-ium-1-amine is sourced from PubChem (CID 18558743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).