C18H16Br2N2OS — CID 18558942
3,8-dibromo-7-ethoxy-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole (PubChem CID 18558942) has the molecular formula C18H16Br2N2OS and a molecular weight of 468.21 g/mol. Its IUPAC name is 3,8-dibromo-7-ethoxy-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole.
| Compound Name | 3,8-dibromo-7-ethoxy-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole |
|---|---|
| PubChem CID | 18558942 |
| Molecular Formula | C18H16Br2N2OS |
| Molecular Weight | 468.21 g/mol |
| Exact Mass | 465.94 |
| IUPAC Name | 3,8-dibromo-7-ethoxy-4-phenyl-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazole |
| SMILES | CCOc1cc2c(cc1Br)nc1n2C(c2ccccc2)C(Br)CS1 |
| InChI | InChI=1S/C18H16Br2N2OS/c1-2-23-16-9-15-14(8-12(16)19)21-18-22(15)17(13(20)10-24-18)11-6-4-3-5-7-11/h3-9,13,17H,2,10H2,1H3 |
| InChIKey | QXCJGZTYLWTZSR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.21 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|