C18H14F3N3O4 — CID 18559147
9-methyl-4-nitro-10-[2-(trifluoromethyl)phenyl]-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one (PubChem CID 18559147) has the molecular formula C18H14F3N3O4 and a molecular weight of 393.32 g/mol. Its IUPAC name is 9-methyl-4-nitro-10-[2-(trifluoromethyl)phenyl]-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one.
| Compound Name | 9-methyl-4-nitro-10-[2-(trifluoromethyl)phenyl]-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
|---|---|
| PubChem CID | 18559147 |
| Molecular Formula | C18H14F3N3O4 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 9-methyl-4-nitro-10-[2-(trifluoromethyl)phenyl]-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
| SMILES | CC12CC(NC(=O)N1c1ccccc1C(F)(F)F)c1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C18H14F3N3O4/c1-17-9-13(11-8-10(24(26)27)6-7-15(11)28-17)22-16(25)23(17)14-5-3-2-4-12(14)18(19,20)21/h2-8,13H,9H2,1H3,(H,22,25) |
| InChIKey | BJSSGCBCYCLQOW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|