C20H20N2O4 — CID 18559368
3-(4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)-2-methylbenzoic acid (PubChem CID 18559368) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-(4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)-2-methylbenzoic acid.
| Compound Name | 3-(4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 18559368 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 3-(4,9-dimethyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl)-2-methylbenzoic acid |
| SMILES | Cc1ccc2c(c1)C1CC(C)(O2)N(c2cccc(C(=O)O)c2C)C(=O)N1 |
| InChI | InChI=1S/C20H20N2O4/c1-11-7-8-17-14(9-11)15-10-20(3,26-17)22(19(25)21-15)16-6-4-5-13(12(16)2)18(23)24/h4-9,15H,10H2,1-3H3,(H,21,25)(H,23,24) |
| InChIKey | BJPRWWXSBAZTPA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |