C28H25ClN2O3 — CID 18560233
2-[6-chloro-3-(4-ethylbenzoyl)-4-oxoquinolin-1-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 18560233) has the molecular formula C28H25ClN2O3 and a molecular weight of 472.97 g/mol. Its IUPAC name is 2-[6-chloro-3-(4-ethylbenzoyl)-4-oxoquinolin-1-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[6-chloro-3-(4-ethylbenzoyl)-4-oxoquinolin-1-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 18560233 |
| Molecular Formula | C28H25ClN2O3 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 2-[6-chloro-3-(4-ethylbenzoyl)-4-oxoquinolin-1-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)Cn2cc(C(=O)c3ccc(CC)cc3)c(=O)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C28H25ClN2O3/c1-3-18-5-9-20(10-6-18)27(33)24-16-31(25-14-11-21(29)15-23(25)28(24)34)17-26(32)30-22-12-7-19(4-2)8-13-22/h5-16H,3-4,17H2,1-2H3,(H,30,32) |
| InChIKey | ZHWXECQGQPFVCC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |