C18H23F2N3O5S — CID 18561585
N'-cyclopentyl-N-[[3-(2,5-difluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]oxamide (PubChem CID 18561585) has the molecular formula C18H23F2N3O5S and a molecular weight of 431.46 g/mol. Its IUPAC name is N'-cyclopentyl-N-[[3-(2,5-difluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]oxamide.
| Compound Name | N'-cyclopentyl-N-[[3-(2,5-difluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 18561585 |
| Molecular Formula | C18H23F2N3O5S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N'-cyclopentyl-N-[[3-(2,5-difluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]oxamide |
| SMILES | O=C(NCC1OCCCN1S(=O)(=O)c1cc(F)ccc1F)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H23F2N3O5S/c19-12-6-7-14(20)15(10-12)29(26,27)23-8-3-9-28-16(23)11-21-17(24)18(25)22-13-4-1-2-5-13/h6-7,10,13,16H,1-5,8-9,11H2,(H,21,24)(H,22,25) |
| InChIKey | IXCNLQGWHHENTD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|