C24H22N6O4S — CID 18562832
N-[2-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzamide (PubChem CID 18562832) has the molecular formula C24H22N6O4S and a molecular weight of 490.55 g/mol. Its IUPAC name is N-[2-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzamide.
| Compound Name | N-[2-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 18562832 |
| Molecular Formula | C24H22N6O4S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-[2-[6-[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl]sulfanyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzamide |
| SMILES | O=C(CSc1ccc2nnc(CCNC(=O)c3ccccc3)n2n1)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H22N6O4S/c31-22(26-17-6-7-18-19(14-17)34-13-12-33-18)15-35-23-9-8-20-27-28-21(30(20)29-23)10-11-25-24(32)16-4-2-1-3-5-16/h1-9,14H,10-13,15H2,(H,25,32)(H,26,31) |
| InChIKey | YFNVEKJOAHJPNA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |