C22H24BrN3O4S — CID 18563369
2-[3-[2-(4-bromoanilino)-2-oxoethyl]sulfonylindol-1-yl]-N,N-diethylacetamide (PubChem CID 18563369) has the molecular formula C22H24BrN3O4S and a molecular weight of 506.42 g/mol. Its IUPAC name is 2-[3-[2-(4-bromoanilino)-2-oxoethyl]sulfonylindol-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[3-[2-(4-bromoanilino)-2-oxoethyl]sulfonylindol-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 18563369 |
| Molecular Formula | C22H24BrN3O4S |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 2-[3-[2-(4-bromoanilino)-2-oxoethyl]sulfonylindol-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cn1cc(S(=O)(=O)CC(=O)Nc2ccc(Br)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H24BrN3O4S/c1-3-25(4-2)22(28)14-26-13-20(18-7-5-6-8-19(18)26)31(29,30)15-21(27)24-17-11-9-16(23)10-12-17/h5-13H,3-4,14-15H2,1-2H3,(H,24,27) |
| InChIKey | HLUGVTYQRATJSD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |