C17H16BrN5O2 — CID 18565556
3-bromo-N-[[1-(4-ethoxyphenyl)tetrazol-5-yl]methyl]benzamide (PubChem CID 18565556) has the molecular formula C17H16BrN5O2 and a molecular weight of 402.25 g/mol. Its IUPAC name is 3-bromo-N-[[1-(4-ethoxyphenyl)tetrazol-5-yl]methyl]benzamide.
| Compound Name | 3-bromo-N-[[1-(4-ethoxyphenyl)tetrazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 18565556 |
| Molecular Formula | C17H16BrN5O2 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 3-bromo-N-[[1-(4-ethoxyphenyl)tetrazol-5-yl]methyl]benzamide |
| SMILES | CCOc1ccc(-n2nnnc2CNC(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C17H16BrN5O2/c1-2-25-15-8-6-14(7-9-15)23-16(20-21-22-23)11-19-17(24)12-4-3-5-13(18)10-12/h3-10H,2,11H2,1H3,(H,19,24) |
| InChIKey | WRAHHRIUCLLDLA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |