C12H15N5O2 — CID 18565616
2-methoxy-N-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]acetamide (PubChem CID 18565616) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is 2-methoxy-N-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]acetamide.
| Compound Name | 2-methoxy-N-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 18565616 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-methoxy-N-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]acetamide |
| SMILES | COCC(=O)NCc1nnnn1-c1ccc(C)cc1 |
| InChI | InChI=1S/C12H15N5O2/c1-9-3-5-10(6-4-9)17-11(14-15-16-17)7-13-12(18)8-19-2/h3-6H,7-8H2,1-2H3,(H,13,18) |
| InChIKey | KNKPMRYRRMXBCE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |