C10H11F2N5O2S — CID 18565858
N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]ethanesulfonamide (PubChem CID 18565858) has the molecular formula C10H11F2N5O2S and a molecular weight of 303.29 g/mol. Its IUPAC name is N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]ethanesulfonamide.
| Compound Name | N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 18565858 |
| Molecular Formula | C10H11F2N5O2S |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-[[1-(3,4-difluorophenyl)tetrazol-5-yl]methyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCc1nnnn1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H11F2N5O2S/c1-2-20(18,19)13-6-10-14-15-16-17(10)7-3-4-8(11)9(12)5-7/h3-5,13H,2,6H2,1H3 |
| InChIKey | AONRKGQXOXVUKE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |