C18H27N5O2S — CID 18566841
N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]propane-1-sulfonamide (PubChem CID 18566841) has the molecular formula C18H27N5O2S and a molecular weight of 377.51 g/mol. Its IUPAC name is N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]propane-1-sulfonamide.
| Compound Name | N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 18566841 |
| Molecular Formula | C18H27N5O2S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(Nc2nc(C)cc(N(CC)CC)n2)cc1 |
| InChI | InChI=1S/C18H27N5O2S/c1-5-12-26(24,25)22-16-10-8-15(9-11-16)20-18-19-14(4)13-17(21-18)23(6-2)7-3/h8-11,13,22H,5-7,12H2,1-4H3,(H,19,20,21) |
| InChIKey | XFEMFWSIFGGTPC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |