C17H13F3N2O2 — CID 18570780
N-(1-methyl-2-oxo-3H-indol-5-yl)-3-(trifluoromethyl)benzamide (PubChem CID 18570780) has the molecular formula C17H13F3N2O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is N-(1-methyl-2-oxo-3H-indol-5-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(1-methyl-2-oxo-3H-indol-5-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18570780 |
| Molecular Formula | C17H13F3N2O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-(1-methyl-2-oxo-3H-indol-5-yl)-3-(trifluoromethyl)benzamide |
| SMILES | CN1C(=O)Cc2cc(NC(=O)c3cccc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C17H13F3N2O2/c1-22-14-6-5-13(8-11(14)9-15(22)23)21-16(24)10-3-2-4-12(7-10)17(18,19)20/h2-8H,9H2,1H3,(H,21,24) |
| InChIKey | TYMSPQWNFZLYDO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |