C21H28ClN3O4S — CID 18571726
N-[2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-2-methylbenzamide;hydrochloride (PubChem CID 18571726) has the molecular formula C21H28ClN3O4S and a molecular weight of 453.99 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-2-methylbenzamide;hydrochloride.
| Compound Name | N-[2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-2-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 18571726 |
| Molecular Formula | C21H28ClN3O4S |
| Molecular Weight | 453.99 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]ethyl]-2-methylbenzamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(CCNC(=O)c3ccccc3C)CC2)cc1.Cl |
| InChI | InChI=1S/C21H27N3O4S.ClH/c1-17-5-3-4-6-20(17)21(25)22-11-12-23-13-15-24(16-14-23)29(26,27)19-9-7-18(28-2)8-10-19;/h3-10H,11-16H2,1-2H3,(H,22,25);1H |
| InChIKey | NFLDSIVVWXWOLE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.99 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |