C17H15ClN2O5S2 — CID 18573121
2-(4-chlorophenyl)sulfonyl-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)acetamide (PubChem CID 18573121) has the molecular formula C17H15ClN2O5S2 and a molecular weight of 426.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 18573121 |
| Molecular Formula | C17H15ClN2O5S2 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)acetamide |
| SMILES | COc1ccc(OC)c2sc(NC(=O)CS(=O)(=O)c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C17H15ClN2O5S2/c1-24-12-7-8-13(25-2)16-15(12)20-17(26-16)19-14(21)9-27(22,23)11-5-3-10(18)4-6-11/h3-8H,9H2,1-2H3,(H,19,20,21) |
| InChIKey | OFVHYTZUBDMLGN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |