About N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide
N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide (PubChem CID 18573645) has the molecular formula C6H13NO4S2
and a molecular weight of 227.31 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide |
| PubChem CID | 18573645 |
| Molecular Formula | C6H13NO4S2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide |
| SMILES | CN(C1CCS(=O)(=O)C1)S(C)(=O)=O |
| InChI | InChI=1S/C6H13NO4S2/c1-7(12(2,8)9)6-3-4-13(10,11)5-6/h6H,3-5H2,1-2H3 |
| InChIKey | YFEPKXBMAOGTGM-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide?
The IUPAC name of N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide (CID 18573645) is N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide.
What is the SMILES notation for N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide?
The canonical SMILES for N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide is CN(C1CCS(=O)(=O)C1)S(C)(=O)=O.
What is the InChIKey of N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide?
The InChIKey is YFEPKXBMAOGTGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO4S2/c1-7(12(2,8)9)6-3-4-13(10,11)5-6/h6H,3-5H2,1-2H3.
What are the key properties of N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide?
N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide has a molecular weight of 227.31 g/mol, XLogP of -0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothiolan-3-yl)-N-methylmethanesulfonamide is sourced from PubChem (CID 18573645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).