About N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide
N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide (PubChem CID 18574537) has the molecular formula C19H26FN3O4S
and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide.
Molecular Properties
| Compound Name | N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide |
| PubChem CID | 18574537 |
| Molecular Formula | C19H26FN3O4S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)NCCC1CCCCN1S(=O)(=O)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C19H26FN3O4S/c1-3-10-21-18(24)19(25)22-11-9-15-6-4-5-12-23(15)28(26,27)16-7-8-17(20)14(2)13-16/h3,7-8,13,15H,1,4-6,9-12H2,2H3,(H,21,24)(H,22,25) |
| InChIKey | KKMABZPWPRUYQD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide?
The IUPAC name of N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide (CID 18574537) is N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide.
What is the SMILES notation for N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide?
The canonical SMILES for N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide is C=CCNC(=O)C(=O)NCCC1CCCCN1S(=O)(=O)c1ccc(F)c(C)c1.
What is the InChIKey of N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide?
The InChIKey is KKMABZPWPRUYQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26FN3O4S/c1-3-10-21-18(24)19(25)22-11-9-15-6-4-5-12-23(15)28(26,27)16-7-8-17(20)14(2)13-16/h3,7-8,13,15H,1,4-6,9-12H2,2H3,(H,21,24)(H,22,25).
What are the key properties of N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide?
N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide has a molecular weight of 411.50 g/mol, XLogP of 1.49, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[1-(4-fluoro-3-methylphenyl)sulfonylpiperidin-2-yl]ethyl]-N'-prop-2-enyloxamide is sourced from PubChem (CID 18574537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).