C24H29FN4O5 — CID 18574689
N'-[2-(1,3-benzodioxol-5-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(2-methoxyethyl)oxamide (PubChem CID 18574689) has the molecular formula C24H29FN4O5 and a molecular weight of 472.52 g/mol. Its IUPAC name is N'-[2-(1,3-benzodioxol-5-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(2-methoxyethyl)oxamide.
| Compound Name | N'-[2-(1,3-benzodioxol-5-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 18574689 |
| Molecular Formula | C24H29FN4O5 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N'-[2-(1,3-benzodioxol-5-yl)-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(2-methoxyethyl)oxamide |
| SMILES | COCCNC(=O)C(=O)NCC(c1ccc2c(c1)OCO2)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H29FN4O5/c1-32-13-8-26-23(30)24(31)27-15-20(17-2-7-21-22(14-17)34-16-33-21)29-11-9-28(10-12-29)19-5-3-18(25)4-6-19/h2-7,14,20H,8-13,15-16H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | NQNFYRMTYFVYIW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|