C25H27N3O2S — CID 18577893
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-thiophen-2-ylethyl]-N'-(3,5-dimethylphenyl)oxamide (PubChem CID 18577893) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-thiophen-2-ylethyl]-N'-(3,5-dimethylphenyl)oxamide.
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-thiophen-2-ylethyl]-N'-(3,5-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 18577893 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-thiophen-2-ylethyl]-N'-(3,5-dimethylphenyl)oxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(=O)NCC(c2cccs2)N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C25H27N3O2S/c1-17-12-18(2)14-21(13-17)27-25(30)24(29)26-15-22(23-8-5-11-31-23)28-10-9-19-6-3-4-7-20(19)16-28/h3-8,11-14,22H,9-10,15-16H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | MBLVHNNDAUOMCU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|