C17H21N5O4S2 — CID 18578442
methyl 4-[[2-[[5-(tert-butylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 18578442) has the molecular formula C17H21N5O4S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is methyl 4-[[2-[[5-(tert-butylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[[5-(tert-butylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18578442 |
| Molecular Formula | C17H21N5O4S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | methyl 4-[[2-[[5-(tert-butylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CSc2nnc(NC(=O)NC(C)(C)C)s2)cc1 |
| InChI | InChI=1S/C17H21N5O4S2/c1-17(2,3)20-14(25)19-15-21-22-16(28-15)27-9-12(23)18-11-7-5-10(6-8-11)13(24)26-4/h5-8H,9H2,1-4H3,(H,18,23)(H2,19,20,21,25) |
| InChIKey | LLFWVEANGDBPEM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|