C21H21FN4O4S — CID 18581786
N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-4-nitrobenzamide (PubChem CID 18581786) has the molecular formula C21H21FN4O4S and a molecular weight of 444.49 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-4-nitrobenzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 18581786 |
| Molecular Formula | C21H21FN4O4S |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-4-nitrobenzamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N(CCCN1CCOCC1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C21H21FN4O4S/c22-16-4-7-18-19(14-16)31-21(23-18)25(9-1-8-24-10-12-30-13-11-24)20(27)15-2-5-17(6-3-15)26(28)29/h2-7,14H,1,8-13H2 |
| InChIKey | BEVJTMAGAURUQU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|