C25H24N2O5S2 — CID 18581973
N-benzyl-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-ethylsulfonylbenzamide (PubChem CID 18581973) has the molecular formula C25H24N2O5S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-benzyl-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-ethylsulfonylbenzamide.
| Compound Name | N-benzyl-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 18581973 |
| Molecular Formula | C25H24N2O5S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | N-benzyl-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)N(Cc1ccccc1)c1nc2c(OC)ccc(OC)c2s1 |
| InChI | InChI=1S/C25H24N2O5S2/c1-4-34(29,30)21-13-9-8-12-18(21)24(28)27(16-17-10-6-5-7-11-17)25-26-22-19(31-2)14-15-20(32-3)23(22)33-25/h5-15H,4,16H2,1-3H3 |
| InChIKey | KLUWDRKPBAIBGI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |