C20H16N4O7 — CID 18582736
N-(2-methoxy-4-nitrophenyl)-1-[(3-nitrophenyl)methyl]-6-oxopyridine-3-carboxamide (PubChem CID 18582736) has the molecular formula C20H16N4O7 and a molecular weight of 424.37 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-1-[(3-nitrophenyl)methyl]-6-oxopyridine-3-carboxamide.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-1-[(3-nitrophenyl)methyl]-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 18582736 |
| Molecular Formula | C20H16N4O7 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-1-[(3-nitrophenyl)methyl]-6-oxopyridine-3-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)c1ccc(=O)n(Cc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H16N4O7/c1-31-18-10-16(24(29)30)6-7-17(18)21-20(26)14-5-8-19(25)22(12-14)11-13-3-2-4-15(9-13)23(27)28/h2-10,12H,11H2,1H3,(H,21,26) |
| InChIKey | DKNVLRZYPHKGCG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|