About N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide
N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide (PubChem CID 18583794) has the molecular formula C16H19F2NO3
and a molecular weight of 311.33 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide |
| PubChem CID | 18583794 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide |
| SMILES | O=C(NCC1COC2(CCCCC2)O1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H19F2NO3/c17-13-5-4-11(8-14(13)18)15(20)19-9-12-10-21-16(22-12)6-2-1-3-7-16/h4-5,8,12H,1-3,6-7,9-10H2,(H,19,20) |
| InChIKey | AGPMDXDAXLWHNT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide?
The IUPAC name of N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide (CID 18583794) is N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide.
What is the SMILES notation for N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide?
The canonical SMILES for N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide is O=C(NCC1COC2(CCCCC2)O1)c1ccc(F)c(F)c1.
What is the InChIKey of N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide?
The InChIKey is AGPMDXDAXLWHNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2NO3/c17-13-5-4-11(8-14(13)18)15(20)19-9-12-10-21-16(22-12)6-2-1-3-7-16/h4-5,8,12H,1-3,6-7,9-10H2,(H,19,20).
What are the key properties of N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide?
N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide has a molecular weight of 311.33 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)-3,4-difluorobenzamide is sourced from PubChem (CID 18583794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).