About N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide
N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide (PubChem CID 18583860) has the molecular formula C18H30N2O4
and a molecular weight of 338.45 g/mol. Its IUPAC name is N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide.
Molecular Properties
| Compound Name | N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide |
| PubChem CID | 18583860 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide |
| SMILES | O=C(NCC1COC2(CCCCC2)O1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C18H30N2O4/c21-16(17(22)20-14-8-4-1-2-5-9-14)19-12-15-13-23-18(24-15)10-6-3-7-11-18/h14-15H,1-13H2,(H,19,21)(H,20,22) |
| InChIKey | XMLNEMCTIJCLFM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide?
The IUPAC name of N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide (CID 18583860) is N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide.
What is the SMILES notation for N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide?
The canonical SMILES for N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide is O=C(NCC1COC2(CCCCC2)O1)C(=O)NC1CCCCCC1.
What is the InChIKey of N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide?
The InChIKey is XMLNEMCTIJCLFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O4/c21-16(17(22)20-14-8-4-1-2-5-9-14)19-12-15-13-23-18(24-15)10-6-3-7-11-18/h14-15H,1-13H2,(H,19,21)(H,20,22).
What are the key properties of N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide?
N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide has a molecular weight of 338.45 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cycloheptyl-N-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)oxamide is sourced from PubChem (CID 18583860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).