About 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol
1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol (PubChem CID 18584564) has the molecular formula C9H14N6O
and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol.
Molecular Properties
| Compound Name | 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol |
| PubChem CID | 18584564 |
| Molecular Formula | C9H14N6O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol |
| SMILES | CCn1nnc2c(NCC(C)O)ncnc21 |
| InChI | InChI=1S/C9H14N6O/c1-3-15-9-7(13-14-15)8(11-5-12-9)10-4-6(2)16/h5-6,16H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | YXOPNGJLHFCBAK-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol?
The IUPAC name of 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol (CID 18584564) is 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol.
What is the SMILES notation for 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol?
The canonical SMILES for 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol is CCn1nnc2c(NCC(C)O)ncnc21.
What is the InChIKey of 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol?
The InChIKey is YXOPNGJLHFCBAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N6O/c1-3-15-9-7(13-14-15)8(11-5-12-9)10-4-6(2)16/h5-6,16H,3-4H2,1-2H3,(H,10,11,12).
What are the key properties of 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol?
1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol has a molecular weight of 222.25 g/mol, XLogP of 0.03, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-ethyltriazolo[4,5-d]pyrimidin-7-yl)amino]propan-2-ol is sourced from PubChem (CID 18584564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).