C22H28N4O4S — CID 18586369
N'-(5,5-dioxo-2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-N-(3,3,5-trimethylcyclohexyl)oxamide (PubChem CID 18586369) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is N'-(5,5-dioxo-2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-N-(3,3,5-trimethylcyclohexyl)oxamide.
| Compound Name | N'-(5,5-dioxo-2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-N-(3,3,5-trimethylcyclohexyl)oxamide |
|---|---|
| PubChem CID | 18586369 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N'-(5,5-dioxo-2-phenyl-4,6-dihydrothieno[3,4-c]pyrazol-3-yl)-N-(3,3,5-trimethylcyclohexyl)oxamide |
| SMILES | CC1CC(NC(=O)C(=O)Nc2c3c(nn2-c2ccccc2)CS(=O)(=O)C3)CC(C)(C)C1 |
| InChI | InChI=1S/C22H28N4O4S/c1-14-9-15(11-22(2,3)10-14)23-20(27)21(28)24-19-17-12-31(29,30)13-18(17)25-26(19)16-7-5-4-6-8-16/h4-8,14-15H,9-13H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | WWDUYCDOJXDBMC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|