About N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide
N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide (PubChem CID 18588751) has the molecular formula C12H15N3O3
and a molecular weight of 249.27 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide.
Molecular Properties
| Compound Name | N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide |
| PubChem CID | 18588751 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide |
| SMILES | O=C(NCC1CCCO1)C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C12H15N3O3/c16-11(14-8-10-2-1-7-18-10)12(17)15-9-3-5-13-6-4-9/h3-6,10H,1-2,7-8H2,(H,14,16)(H,13,15,17) |
| InChIKey | NNOFOOPYKISCHT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide?
The IUPAC name of N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide (CID 18588751) is N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide.
What is the SMILES notation for N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide?
The canonical SMILES for N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide is O=C(NCC1CCCO1)C(=O)Nc1ccncc1.
What is the InChIKey of N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide?
The InChIKey is NNOFOOPYKISCHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O3/c16-11(14-8-10-2-1-7-18-10)12(17)15-9-3-5-13-6-4-9/h3-6,10H,1-2,7-8H2,(H,14,16)(H,13,15,17).
What are the key properties of N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide?
N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide has a molecular weight of 249.27 g/mol, XLogP of 0.32, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-2-ylmethyl)-N'-pyridin-4-yloxamide is sourced from PubChem (CID 18588751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).