C16H22N2O2S2 — CID 18589434
N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-phenylethanesulfonamide (PubChem CID 18589434) has the molecular formula C16H22N2O2S2 and a molecular weight of 338.50 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-phenylethanesulfonamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 18589434 |
| Molecular Formula | C16H22N2O2S2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-2-phenylethanesulfonamide |
| SMILES | CN(C)C(CNS(=O)(=O)CCc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C16H22N2O2S2/c1-18(2)15(16-9-6-11-21-16)13-17-22(19,20)12-10-14-7-4-3-5-8-14/h3-9,11,15,17H,10,12-13H2,1-2H3 |
| InChIKey | CVJCXNUBCOBWOD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |