About 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride
2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride (PubChem CID 18590771) has the molecular formula C18H31ClN2O
and a molecular weight of 326.91 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride |
| PubChem CID | 18590771 |
| Molecular Formula | C18H31ClN2O |
| Molecular Weight | 326.91 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride |
| SMILES | CN1CCN(CC(=O)C23CC4CCC(CC(C4)C2)C3)CC1.Cl |
| InChI | InChI=1S/C18H30N2O.ClH/c1-19-4-6-20(7-5-19)13-17(21)18-10-14-2-3-15(11-18)9-16(8-14)12-18;/h14-16H,2-13H2,1H3;1H |
| InChIKey | FPKKTXOZNWGBNX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.91 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride?
The IUPAC name of 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride (CID 18590771) is 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride.
What is the SMILES notation for 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride?
The canonical SMILES for 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride is CN1CCN(CC(=O)C23CC4CCC(CC(C4)C2)C3)CC1.Cl.
What is the InChIKey of 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride?
The InChIKey is FPKKTXOZNWGBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O.ClH/c1-19-4-6-20(7-5-19)13-17(21)18-10-14-2-3-15(11-18)9-16(8-14)12-18;/h14-16H,2-13H2,1H3;1H.
What are the key properties of 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride?
2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride has a molecular weight of 326.91 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylpiperazin-1-yl)-1-(1-tricyclo[4.3.1.13,8]undecanyl)ethanone;hydrochloride is sourced from PubChem (CID 18590771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).