C22H24N2O6S2 — CID 18591426
methyl 4-methoxy-3-[[3-(3-methylsulfanylphenyl)-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]methyl]benzoate (PubChem CID 18591426) has the molecular formula C22H24N2O6S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is methyl 4-methoxy-3-[[3-(3-methylsulfanylphenyl)-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]methyl]benzoate.
| Compound Name | methyl 4-methoxy-3-[[3-(3-methylsulfanylphenyl)-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 18591426 |
| Molecular Formula | C22H24N2O6S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | methyl 4-methoxy-3-[[3-(3-methylsulfanylphenyl)-2,5,5-trioxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(OC)c(CN2C(=O)N(c3cccc(SC)c3)C3CS(=O)(=O)CC32)c1 |
| InChI | InChI=1S/C22H24N2O6S2/c1-29-20-8-7-14(21(25)30-2)9-15(20)11-23-18-12-32(27,28)13-19(18)24(22(23)26)16-5-4-6-17(10-16)31-3/h4-10,18-19H,11-13H2,1-3H3 |
| InChIKey | YARMSWDCYNBBJD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|