C22H19N3O6S — CID 18591780
2-(4-ethoxyphenyl)-4-[(3-nitrophenyl)methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 18591780) has the molecular formula C22H19N3O6S and a molecular weight of 453.48 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-4-[(3-nitrophenyl)methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 2-(4-ethoxyphenyl)-4-[(3-nitrophenyl)methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 18591780 |
| Molecular Formula | C22H19N3O6S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 2-(4-ethoxyphenyl)-4-[(3-nitrophenyl)methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | CCOc1ccc(N2C(=O)N(Cc3cccc([N+](=O)[O-])c3)c3ccccc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C22H19N3O6S/c1-2-31-19-12-10-17(11-13-19)24-22(26)23(15-16-6-5-7-18(14-16)25(27)28)20-8-3-4-9-21(20)32(24,29)30/h3-14H,2,15H2,1H3 |
| InChIKey | MUXXJVXFLRKSMP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|