C20H19F2N3O3 — CID 18591923
1-(3,4-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethylamino]pyrazin-2-one (PubChem CID 18591923) has the molecular formula C20H19F2N3O3 and a molecular weight of 387.39 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethylamino]pyrazin-2-one.
| Compound Name | 1-(3,4-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 18591923 |
| Molecular Formula | C20H19F2N3O3 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethylamino]pyrazin-2-one |
| SMILES | COc1ccc(CCNc2nccn(-c3ccc(F)c(F)c3)c2=O)cc1OC |
| InChI | InChI=1S/C20H19F2N3O3/c1-27-17-6-3-13(11-18(17)28-2)7-8-23-19-20(26)25(10-9-24-19)14-4-5-15(21)16(22)12-14/h3-6,9-12H,7-8H2,1-2H3,(H,23,24) |
| InChIKey | SPOLIUINXHGXKA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |