C23H24N2O3S — CID 18592500
[2-(3,5-dimethoxyphenyl)-3-sulfanylidene-1,4-diazaspiro[4.5]dec-1-en-4-yl]-phenylmethanone (PubChem CID 18592500) has the molecular formula C23H24N2O3S and a molecular weight of 408.52 g/mol. Its IUPAC name is [2-(3,5-dimethoxyphenyl)-3-sulfanylidene-1,4-diazaspiro[4.5]dec-1-en-4-yl]-phenylmethanone.
| Compound Name | [2-(3,5-dimethoxyphenyl)-3-sulfanylidene-1,4-diazaspiro[4.5]dec-1-en-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 18592500 |
| Molecular Formula | C23H24N2O3S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [2-(3,5-dimethoxyphenyl)-3-sulfanylidene-1,4-diazaspiro[4.5]dec-1-en-4-yl]-phenylmethanone |
| SMILES | COc1cc(OC)cc(C2=NC3(CCCCC3)N(C(=O)c3ccccc3)C2=S)c1 |
| InChI | InChI=1S/C23H24N2O3S/c1-27-18-13-17(14-19(15-18)28-2)20-22(29)25(21(26)16-9-5-3-6-10-16)23(24-20)11-7-4-8-12-23/h3,5-6,9-10,13-15H,4,7-8,11-12H2,1-2H3 |
| InChIKey | RKKDDBCISBLHBS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|