C24H26N2O3S — CID 18592509
(3,4-dimethoxyphenyl)-[2-(4-methylphenyl)-3-sulfanylidene-1,4-diazaspiro[4.5]dec-1-en-4-yl]methanone (PubChem CID 18592509) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[2-(4-methylphenyl)-3-sulfanylidene-1,4-diazaspiro[4.5]dec-1-en-4-yl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[2-(4-methylphenyl)-3-sulfanylidene-1,4-diazaspiro[4.5]dec-1-en-4-yl]methanone |
|---|---|
| PubChem CID | 18592509 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[2-(4-methylphenyl)-3-sulfanylidene-1,4-diazaspiro[4.5]dec-1-en-4-yl]methanone |
| SMILES | COc1ccc(C(=O)N2C(=S)C(c3ccc(C)cc3)=NC23CCCCC3)cc1OC |
| InChI | InChI=1S/C24H26N2O3S/c1-16-7-9-17(10-8-16)21-23(30)26(24(25-21)13-5-4-6-14-24)22(27)18-11-12-19(28-2)20(15-18)29-3/h7-12,15H,4-6,13-14H2,1-3H3 |
| InChIKey | ICZJLTNZMQYIIW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|