C16H15NO2S2 — CID 18592929
13-oxa-3,7-dithia-5-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),14,16,18-tetraen-4-one (PubChem CID 18592929) has the molecular formula C16H15NO2S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 13-oxa-3,7-dithia-5-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),14,16,18-tetraen-4-one.
| Compound Name | 13-oxa-3,7-dithia-5-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),14,16,18-tetraen-4-one |
|---|---|
| PubChem CID | 18592929 |
| Molecular Formula | C16H15NO2S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 13-oxa-3,7-dithia-5-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),14,16,18-tetraen-4-one |
| SMILES | O=c1[nH]c2c(s1)C1c3ccccc3OC3CCCC(S2)C31 |
| InChI | InChI=1S/C16H15NO2S2/c18-16-17-15-14(21-16)12-8-4-1-2-5-9(8)19-10-6-3-7-11(20-15)13(10)12/h1-2,4-5,10-13H,3,6-7H2,(H,17,18) |
| InChIKey | RPODNVZRIFIAQZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|