About 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide
4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 18593150) has the molecular formula C25H23N3O5S
and a molecular weight of 477.54 g/mol. Its IUPAC name is 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide.
Molecular Properties
| Compound Name | 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide |
| PubChem CID | 18593150 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | CN(CCCC(=O)NCc1cccnc1)S(=O)(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H23N3O5S/c1-28(13-5-9-23(29)27-16-17-6-4-12-26-15-17)34(32,33)18-10-11-21-22(14-18)25(31)20-8-3-2-7-19(20)24(21)30/h2-4,6-8,10-12,14-15H,5,9,13,16H2,1H3,(H,27,29) |
| InChIKey | VVWSCZMCORIRSY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide?
The IUPAC name of 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide (CID 18593150) is 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide.
What is the SMILES notation for 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide?
The canonical SMILES for 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide is CN(CCCC(=O)NCc1cccnc1)S(=O)(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O.
What is the InChIKey of 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide?
The InChIKey is VVWSCZMCORIRSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N3O5S/c1-28(13-5-9-23(29)27-16-17-6-4-12-26-15-17)34(32,33)18-10-11-21-22(14-18)25(31)20-8-3-2-7-19(20)24(21)30/h2-4,6-8,10-12,14-15H,5,9,13,16H2,1H3,(H,27,29).
What are the key properties of 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide?
4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide has a molecular weight of 477.54 g/mol, XLogP of 2.57, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(9,10-dioxoanthracen-2-yl)sulfonyl-methylamino]-N-(pyridin-3-ylmethyl)butanamide is sourced from PubChem (CID 18593150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).