About 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride
1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride (PubChem CID 18593623) has the molecular formula C22H16Cl3N3O
and a molecular weight of 444.75 g/mol. Its IUPAC name is 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride |
| PubChem CID | 18593623 |
| Molecular Formula | C22H16Cl3N3O |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride |
| SMILES | CC(=O)c1cccc(Nc2nc(-c3ccc(Cl)cc3Cl)nc3ccccc23)c1.Cl |
| InChI | InChI=1S/C22H15Cl2N3O.ClH/c1-13(28)14-5-4-6-16(11-14)25-22-18-7-2-3-8-20(18)26-21(27-22)17-10-9-15(23)12-19(17)24;/h2-12H,1H3,(H,25,26,27);1H |
| InChIKey | AAUQCTJEYNYNOP-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride?
The IUPAC name of 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride (CID 18593623) is 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride.
What is the SMILES notation for 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride?
The canonical SMILES for 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride is CC(=O)c1cccc(Nc2nc(-c3ccc(Cl)cc3Cl)nc3ccccc23)c1.Cl.
What is the InChIKey of 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride?
The InChIKey is AAUQCTJEYNYNOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15Cl2N3O.ClH/c1-13(28)14-5-4-6-16(11-14)25-22-18-7-2-3-8-20(18)26-21(27-22)17-10-9-15(23)12-19(17)24;/h2-12H,1H3,(H,25,26,27);1H.
What are the key properties of 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride?
1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride has a molecular weight of 444.75 g/mol, XLogP of 6.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]phenyl]ethanone;hydrochloride is sourced from PubChem (CID 18593623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).