About 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid
2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid (PubChem CID 18593861) has the molecular formula C25H24ClNO8
and a molecular weight of 501.92 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid |
| PubChem CID | 18593861 |
| Molecular Formula | C25H24ClNO8 |
| Molecular Weight | 501.92 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid |
| SMILES | COc1ccc(/N=c2\cc(-c3ccc(OC)c(OC)c3)oc3ccc(C)cc23)cc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C25H23NO4.ClHO4/c1-16-5-11-22-20(13-16)21(26-18-7-9-19(27-2)10-8-18)15-24(30-22)17-6-12-23(28-3)25(14-17)29-4;2-1(3,4)5/h5-15H,1-4H3;(H,2,3,4,5)/b26-21+; |
| InChIKey | QTXLFLCIBYAHID-HCPJHKKFSA-N |
| XLogP | 1.54 |
| TPSA | 142.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 501.92 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid (CID 18593861) is 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid is COc1ccc(/N=c2\cc(-c3ccc(OC)c(OC)c3)oc3ccc(C)cc23)cc1.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid?
The InChIKey is QTXLFLCIBYAHID-HCPJHKKFSA-N. The full InChI is InChI=1S/C25H23NO4.ClHO4/c1-16-5-11-22-20(13-16)21(26-18-7-9-19(27-2)10-8-18)15-24(30-22)17-6-12-23(28-3)25(14-17)29-4;2-1(3,4)5/h5-15H,1-4H3;(H,2,3,4,5)/b26-21+;.
What are the key properties of 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid?
2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid has a molecular weight of 501.92 g/mol, XLogP of 1.54, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-N-(4-methoxyphenyl)-6-methylchromen-4-imine;perchloric acid is sourced from PubChem (CID 18593861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).