About N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide
N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide (PubChem CID 18593877) has the molecular formula C9H19NO4S2
and a molecular weight of 269.39 g/mol. Its IUPAC name is N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide.
Molecular Properties
| Compound Name | N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide |
| PubChem CID | 18593877 |
| Molecular Formula | C9H19NO4S2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide |
| SMILES | CCCCN(C)S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H19NO4S2/c1-3-4-6-10(2)16(13,14)9-5-7-15(11,12)8-9/h9H,3-8H2,1-2H3 |
| InChIKey | ILYXSQOBYMHQKY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide?
The IUPAC name of N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide (CID 18593877) is N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide.
What is the SMILES notation for N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide?
The canonical SMILES for N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide is CCCCN(C)S(=O)(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide?
The InChIKey is ILYXSQOBYMHQKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO4S2/c1-3-4-6-10(2)16(13,14)9-5-7-15(11,12)8-9/h9H,3-8H2,1-2H3.
What are the key properties of N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide?
N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide has a molecular weight of 269.39 g/mol, XLogP of 0.24, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-methyl-1,1-dioxothiolane-3-sulfonamide is sourced from PubChem (CID 18593877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).