C24H34CuO14 — CID 18594021
copper bis((1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate) (PubChem CID 18594021) has the molecular formula C24H34CuO14 and a molecular weight of 610.07 g/mol. Its IUPAC name is copper bis((1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate).
| Compound Name | copper bis((1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate) |
|---|---|
| PubChem CID | 18594021 |
| Molecular Formula | C24H34CuO14 |
| Molecular Weight | 610.07 g/mol |
| Exact Mass | 609.12 |
| IUPAC Name | copper bis((1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate) |
| SMILES | CC1(C)OC[C@@H]2O[C@@]3(C(=O)[O-])OC(C)(C)O[C@H]3[C@@H]2O1.CC1(C)OC[C@@H]2O[C@@]3(C(=O)[O-])OC(C)(C)O[C@H]3[C@@H]2O1.[Cu+2] |
| InChI | InChI=1S/2C12H18O7.Cu/c2*1-10(2)15-5-6-7(17-10)8-12(16-6,9(13)14)19-11(3,4)18-8;/h2*6-8H,5H2,1-4H3,(H,13,14);/q;;+2/p-2/t2*6-,7+,8-,12+;/m00./s1 |
| InChIKey | CSFOWXFXRZGADQ-GADKYXIFSA-L |
| XLogP | -1.73 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.07 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |