C24H39FO6S2 — CID 18594061
[(6S,7R,8R,9R,10S,13R,14S,16R,17R)-17-ethyl-9-fluoro-10,13,16-trimethyl-6-methylsulfonyloxy-1,2,3,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] methanesulfonate (PubChem CID 18594061) has the molecular formula C24H39FO6S2 and a molecular weight of 506.70 g/mol. Its IUPAC name is [(6S,7R,8R,9R,10S,13R,14S,16R,17R)-17-ethyl-9-fluoro-10,13,16-trimethyl-6-methylsulfonyloxy-1,2,3,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] methanesulfonate.
| Compound Name | [(6S,7R,8R,9R,10S,13R,14S,16R,17R)-17-ethyl-9-fluoro-10,13,16-trimethyl-6-methylsulfonyloxy-1,2,3,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 18594061 |
| Molecular Formula | C24H39FO6S2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | [(6S,7R,8R,9R,10S,13R,14S,16R,17R)-17-ethyl-9-fluoro-10,13,16-trimethyl-6-methylsulfonyloxy-1,2,3,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-yl] methanesulfonate |
| SMILES | CC[C@@H]1[C@H](C)C[C@H]2[C@@H]3[C@@H](OS(C)(=O)=O)[C@@H](OS(C)(=O)=O)C4=CCCC[C@]4(C)[C@@]3(F)CC[C@]12C |
| InChI | InChI=1S/C24H39FO6S2/c1-7-16-15(2)14-18-19-21(31-33(6,28)29)20(30-32(5,26)27)17-10-8-9-11-23(17,4)24(19,25)13-12-22(16,18)3/h10,15-16,18-21H,7-9,11-14H2,1-6H3/t15-,16-,18+,19-,20+,21-,22-,23+,24-/m1/s1 |
| InChIKey | SCDXYLVNBGHYPM-BIZYHARHSA-N |
| XLogP | 4.61 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|